| Identification | |
| Name: | 9-Hydroxyfluorene |
| Synonyms: | Fluoren-9-ol(6CI,7CI,8CI);9-Fluorenyl alcohol;9-Hydroxy-9H-fluorene;9H-Fluoren-9-ol;NSC 5320;9-Fluorenol; |
| CAS: | 1689-64-1 |
| EINECS: | 216-879-0 |
| Molecular Formula: | C13H10O |
| Molecular Weight: | 182.22 |
| InChI: | InChI=1/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 131.3 ºC |
| Boiling Point: | 367.5ºC at 760 mmHg |
| Density: | 1.253 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.687 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | off-white crystalline powder |
| Specification: |
9H-Fluoren-9-ol , its CAS NO. is 1689-64-1, the synonyms are 9-Hydroxyfluorene ; EINECS 216-879-0 ; Fluoren-9-ol ; Fluorenol ; NSC 5320 . |
| Flash Point: | 131.3 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
