| Identification | |
| Name: | nitroxinil |
| Synonyms: | Nitroxynil; 4-hydroxy-3-iodo-5-nitrobenzonitril; 4-hydroxy-3-iodo-5-nitro benzonitril |
| CAS: | 1689-89-0 |
| EINECS: | 216-884-8 |
| Molecular Formula: | C7H3IN2O3 |
| Molecular Weight: | 290.02 |
| InChI: | InChI=1/C7H3IN2O3/c8-5-1-4(3-9)2-6(7(5)11)10(12)13/h1-2,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 136 - 139 C |
| Density: | 2.24 g/cm3 |
| Refractive index: | 1.735 |
| Water Solubility: | Insoluble(sparingly soluble in either, slightly soluble in ethanol) |
| Solubility: | Insoluble(sparingly soluble in either, slightly soluble in ethanol) |
| Appearance: | white to yellow powder |
| Specification: |
?Nitroxinil , its CAS NO. is 1689-89-0, the synonyms are 4-Hydroxy-3-iodo-5-nitrobenzonitrile ; Benzonitrile, 4-hydroxy-3-iodo-5-nitro- . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
