| Identification | |
| Name: | Bromoxynil octanoate |
| Synonyms: | Octanoicacid, ester with 3,5-dibromo-4-hydroxybenzonitrile (7CI,8CI);2,6-Dibromo-4-cyanophenyl octanoate; 3,5-Dibromo-4-hydroxybenzonitrileoctanoate ester; 3,5-Dibromo-4-n-octanoyloxybenzonitrile;3,5-Dibromo-4-octanoyloxybenzonitrile; 4-Cyano-2,6-dibromophenyl octanoate;Brominal W; Bromoxynil n-octanoyl ester; Bromoxynil octanoate; Bromoxyniloctanoic acid ester; Buctril; Certrol B; NPH 1320 |
| CAS: | 1689-99-2 |
| EINECS: | 216-885-3 |
| Molecular Formula: | C15H17 Br2 N O2 |
| Molecular Weight: | 403.11 |
| InChI: | InChI=1/C15H17Br2NO2/c1-2-3-4-5-6-7-14(19)20-15-12(16)8-11(10-18)9-13(15)17/h8-9H,2-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 210.6°C |
| Boiling Point: | 424.6°C at 760 mmHg |
| Density: | 1.54g/cm3 |
| Refractive index: | 1.572 |
| Solubility: | In water, 0.08 mg/L at 25 deg C In chloroform 800, xylene, dimethylformamide 700, ethyl acetate 620, cyclohexanone 550, carbon tetrachloride 500, n-propanol 120, acetone, ethanol 100 (all in g/L 20-25 deg C) |
| Specification: |
Bromoxynil octanoate (1689-99-2) is a slight yellow solid with aromatic hydrocarbon, which can be applied to cereal crops. It is stable under normal conditions of use and should store in the closed, original container in a dry, cool, well-ventilated area out of direct sunlight. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 210.6°C |
| Color: | Cream, waxy solid Clear, amber waxy solid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
