| Identification | |
| Name: | Boronicacid, B-3-pyridinyl- |
| Synonyms: | 3-Pyridineboronicacid (7CI,8CI);Boronic acid, 3-pyridinyl- (9CI);(3-Pyridinyl)boronic acid;Dihydroxy(3-pyridyl)borane;Pyridin-3-ylboronic acid;Pyridine-3-boronic acid; |
| CAS: | 1692-25-7 |
| Molecular Formula: | C5H6BNO2 |
| Molecular Weight: | 122.92 |
| InChI: | InChI=1/C5H6BNO2/c8-6(9)5-2-1-3-7-4-5/h1-4,8-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.5oC |
| Boiling Point: | 308.8oC at 760 mmHg |
| Density: | 1.22 g/cm3 |
| Refractive index: | 1.534 |
| Appearance: | Light yellow powder |
| Specification: | Light Yellow Powder usageEng:Boronic acid derivatives and their binding affinities with diols. Safety Statements:36/37/39-3-26-45-16 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 3:Keep in a cool place 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Flash Point: | 140.5oC |
| Usage: | Boronic acid derivatives and their binding affinities with diols. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
