| Identification |
| Name: | Cyclobutaneundecanoicacid, 2-oxo- |
| Synonyms: | 2-Oxo-cyclobutane Undecanoic Acid |
| CAS: | 169263-77-8 |
| Molecular Formula: | C15H26 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H26O3/c16-14-12-11-13(14)9-7-5-3-1-2-4-6-8-10-15(17)18/h13H,1-12H2,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 213.486°C |
| Boiling Point: | 405.978°C at 760 mmHg |
| Density: | 1.025g/cm3 |
| Refractive index: | 1.485 |
| Flash Point: | 213.486°C |
| Usage: | A 2-substituted cyclobutanone used in the development of an enzyme-linked immunosorbent assy (ELSA) for the detection of irradiated foods |
| Safety Data |
| |
 |
