Identification |
Name: | 2,4-Pentanedione,3-chloro- |
Synonyms: | 1-Acetyl-1-chloroacetone;3-Chloro-2,4-dioxopentane; 3-Chloro-2,4-pentadione; 3-Chloro-2,4-pentanedione;3-Chloroacetylacetone; 3-Chloropentan-2,4-dione; a-Chloroacetylacetone |
CAS: | 1694-29-7 |
EINECS: | 216-902-4 |
Molecular Formula: | C5H7 Cl O2 |
Molecular Weight: | 134.56 |
InChI: | InChI=1/C5H7ClO2/c1-3(7)5(6)4(2)8/h7H,1-2H3/b5-3- |
Molecular Structure: |
![(C5H7ClO2) 1-Acetyl-1-chloroacetone;3-Chloro-2,4-dioxopentane; 3-Chloro-2,4-pentadione; 3-Chloro-2,4-pentanedio...](https://img1.guidechem.com/chem/e/dict/24/1694-29-7.jpg) |
Properties |
Transport: | UN 1224 3/PG 3 |
Melting Point: | -15 °C
|
Flash Point: | 12.2°C |
Boiling Point: | 49-52 °C18 mm Hg(lit.)
|
Density: | 1.149g/cm3 |
Refractive index: | n20/D 1.483(lit.) |
Specification: | clear yellow to very deep brown liquid Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Packinggroup: | II |
Flash Point: | 12.2°C |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
![](/images/detail_15.png) |