| Identification | |
| Name: | 2,4-Pentanedione,3-chloro- |
| Synonyms: | 1-Acetyl-1-chloroacetone;3-Chloro-2,4-dioxopentane; 3-Chloro-2,4-pentadione; 3-Chloro-2,4-pentanedione;3-Chloroacetylacetone; 3-Chloropentan-2,4-dione; a-Chloroacetylacetone |
| CAS: | 1694-29-7 |
| EINECS: | 216-902-4 |
| Molecular Formula: | C5H7 Cl O2 |
| Molecular Weight: | 134.56 |
| InChI: | InChI=1/C5H7ClO2/c1-3(7)5(6)4(2)8/h7H,1-2H3/b5-3- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 3/PG 3 |
| Melting Point: | -15 °C |
| Flash Point: | 12.2°C |
| Boiling Point: | 49-52 °C18 mm Hg(lit.) |
| Density: | 1.149g/cm3 |
| Refractive index: | n20/D 1.483(lit.) |
| Specification: | clear yellow to very deep brown liquid Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | II |
| Flash Point: | 12.2°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
