| Identification | |
| Name: | 2-Pentenoic acid,2-methyl-, (2E)- |
| Synonyms: | 2-Pentenoicacid, 2-methyl-, (E)- (8CI); (E)-2-Methyl-2-pentenoic acid;(E)-2-Methyl-2-pentenoyl chloride; trans-2-Methyl-2-pentenoic acid |
| CAS: | 16957-70-3 |
| EINECS: | 241-026-4 |
| Molecular Formula: | C6H10 O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h4H,3H2,1-2H3,(H,7,8)/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Melting Point: | 26-28 ºC |
| Flash Point: | 107 ºC |
| Boiling Point: | 123-125 ºC (30 mmHg) |
| Density: | 0.979 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4585-1.4605 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colorless to pale yellow liquid. Fruity odor. |
| Specification: |
2-Pentenoic acid,2-methyl-, (2E)- , its CAS NO. is 16957-70-3, the synonyms are EINECS 241-026-4 ; trans-2-Methyl-2-pentenoic acid ; (E)-2-Methylpent-2-en-1-oic acid . |
| Packinggroup: | III |
| Flash Point: | 107 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
