| Identification | |
| Name: | N,N-Diethylbenzamide |
| Synonyms: | - |
| CAS: | 1696-17-9 |
| EINECS: | 216-912-9 |
| Molecular Formula: | C11H15NO |
| Molecular Weight: | 177.24 |
| InChI: | InChI=1/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 38-40°C |
| Flash Point: | 125.5°C |
| Boiling Point: | 146-150°C 15mm |
| Density: | 0.997g/cm3 |
| Refractive index: | 1.518 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 125.5°C |
| Safety Data | |
 |
|
