| Identification | |
| Name: | 4-Chloro-5-fluoroindole |
| Synonyms: | 4-chloro-5-fluoro-1H-indole |
| CAS: | 169674-02-6 |
| Molecular Formula: | C8H5ClFN |
| Molecular Weight: | 169.58 |
| InChI: | InChI=1/C8H5ClFN/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-4,11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.436 |
| Refractive index: | 1.657 |
| Specification: |
The cas register number of 4-Chloro-5-fluoroindole is 169674-02-6. It also can be called as 1H-indole, 4-chloro-5-fluoro- and the Systematic name about this chemical is 4-chloro-5-fluoro-1H-indole. Physical properties about 4-Chloro-5-fluoroindole are: (1)ACD/LogP: 3.41; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 94; (6)ACD/BCF (pH 7.4): 94; (7)ACD/KOC (pH 5.5): 899; (8)ACD/KOC (pH 7.4): 899; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 15.79 Å2; (13)Index of Refraction: 1.657; (14)Molar Refractivity: 43.417 cm3; (15)Molar Volume: 118.032 cm3; (16)Surface Tension: 49.898 dyne/cm; (17)Density: 1.437 g/cm3; (18)Flash Point: 135.099 °C; (19)Enthalpy of Vaporization: 51.82 kJ/mol; (20)Boiling Point: 299.774 °C at 760 mmHg; (21)Vapour Pressure: 0.002 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
