| Identification | |
| Name: | Benzenemethanol,3-(phenylmethoxy)- |
| Synonyms: | Benzylalcohol, m-(benzyloxy)- (6CI,7CI);(3-Benzyloxyphenyl)methanol;3-(Benzyloxy)benzyl alcohol;3-Benzyloxybenzylic alcohol; |
| CAS: | 1700-30-7 |
| EINECS: | 216-931-2 |
| Molecular Formula: | C14H14O2 |
| Molecular Weight: | 214.26 |
| InChI: | InChI=1/C14H14O2/c15-10-13-7-4-8-14(9-13)16-11-12-5-2-1-3-6-12/h1-9,15H,10-11H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 170.6°C |
| Boiling Point: | 371.9°Cat760mmHg |
| Density: | 1.139g/cm3 |
| Refractive index: | 1.582 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde Safety Statements:37/39-26-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 170.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
