| Identification | |
| Name: | Benzenamine,4-[2-(4-chloro-3-methylphenyl)diazenyl]-N,N-dimethyl- |
| Synonyms: | Aniline,p-[(4-chloro-m-tolyl)azo]-N,N-dimethyl- (8CI); Benzenamine,4-[(4-chloro-3-methylphenyl)azo]-N,N-dimethyl- (9CI);3'-Methyl-4'-chloro-4-(dimethylamino)azobenzene |
| CAS: | 17010-59-2 |
| Molecular Formula: | C15H16 Cl N3 |
| Molecular Weight: | 273.79 |
| InChI: | InChI=1/C15H16ClN3/c1-11-10-13(6-9-15(11)16)18-17-12-4-7-14(8-5-12)19(2)3/h4-10H,1-3H3/b18-17+ |
| Molecular Structure: | ![(C15H16ClN3) Aniline,p-[(4-chloro-m-tolyl)azo]-N,N-dimethyl- (8CI); Benzenamine,4-[(4-chloro-3-methylphenyl)azo]-...](https://img1.guidechem.com/chem/e/dict/42/17010-59-2.jpg) |
| Properties | |
| Flash Point: | 207.5°C |
| Boiling Point: | 419.5°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.575 |
| Specification: |
Aniline, p-((4-chloro-m-tolyl)azo-N,N-dimethyl- (CAS NO.17010-59-2) can be called 4'-Chloro-3'-methyl-4-dimethylaminoazobenzene ; Aniline, N,N-dimethyl-p-(4'-chloro-3'-methylphenylazo)- ; N,N-Dimethyl-p-((4-chloro-m-tolyl)azo)aniline ; p-((4-Chloro-m-tolyl)azo)-N,N-dimethylaniline and so on. |
| Flash Point: | 207.5°C |
| Safety Data | |
 |
|
