| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 2-methyl-6-phenyl-, ethyl ester |
| Synonyms: | Nicotinicacid, 2-methyl-6-phenyl-, ethyl ester (6CI,7CI,8CI);Ethyl2-methyl-6-phenylnicotinate; |
| CAS: | 1702-14-3 |
| Molecular Formula: | C15H15NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H15NO2/c1-3-18-15(17)13-9-10-14(16-11(13)2)12-7-5-4-6-8-12/h4-10H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.103 g/cm3 |
| Refractive index: | 1.554 |
| Specification: |
The Ethyl 2-methyl-6-phenylpyridine-3-carboxylate with the cas number 1702-14-3 is also called 3-Pyridinecarboxylicacid, 2-methyl-6-phenyl-, ethyl ester. Its molecular formula is C15H15NO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 4.21; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.2; (4)ACD/LogD (pH 7.4): 4.21; (5)ACD/BCF (pH 5.5): 921.48; (6)ACD/BCF (pH 7.4): 926.3; (7)ACD/KOC (pH 5.5): 4601.78; (8)ACD/KOC (pH 7.4): 4625.86; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 39.19 Å2; (13)Index of Refraction: 1.554; (14)Molar Refractivity: 70.16 cm3; (15)Molar Volume: 218.6 cm3; (16)Polarizability: 27.81×10-24cm3; (17)Surface Tension: 42.1 dyne/cm; (18)Enthalpy of Vaporization: 58.49 kJ/mol; (19)Vapour Pressure: 8.14×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
