| Identification | |
| Name: | Methyl 2-bromothiazole-4-carboxylate |
| Synonyms: | 4-Thiazolecarboxylicacid, 2-bromo-, methyl ester;2-Bromo-1,3-thiazole-4-carboxylicacid methyl ester;2-Bromothiazole-4-carboxylic acid methyl ester; |
| CAS: | 170235-26-4 |
| Molecular Formula: | C5H4BrNO2S |
| Molecular Weight: | 222.06 |
| InChI: | InChI=1/C5H4BrNO2S/c1-9-4(8)3-2-10-5(6)7-3/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 118-122 |
| Density: | 1.759 g/cm3 |
| Refractive index: | 1.583 |
| Specification: |
Methyl 2-bromothiazole-4-carboxylate , its cas register number is 170235-26-4. It also can be called Methyl 2-bromo-1,3-thiazole-4-carboxylate ; MolPort-000-139-388 ; and 4-Thiazolecarboxylic acid, 2-bromo-, methyl ester . |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
