| Identification |
| Name: | Phenanthrene, 9-iodo- |
| Synonyms: | 9-Iodophenanthrene;9-Phenanthryl iodide; NSC 89105 |
| CAS: | 17024-12-3 |
| Molecular Formula: | C14H9 I |
| Molecular Weight: | 304.12573 |
| InChI: | InChI=1S/C14H9I/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 91-93 °C(lit.)
|
| Flash Point: | 186.6°C |
| Boiling Point: | 411°Cat760mmHg |
| Density: | 1.692g/cm3 |
| Stability: | Stable, but light sensitive - store in the dark. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.772 |
| Water Solubility: | Stability Stable, but light sensitive - store in the dark. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicity data |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 186.6°C |
| Safety Data |
| |
 |
