Identification |
Name: | Ethanol,2-[2-(dimethylamino)ethoxy]- |
Synonyms: | (N,N-Dimethylaminoethoxy)ethanol;2-(2-N,N-Dimethylaminoethoxy)ethanol;2-(N,N-Dimethylaminoethoxy)ethanol;2-[2-(Dimethylamino)ethoxy]ethanol;5-(Dimethylamino)-3-oxapentan-1-ol;JeffcatZR 70;Kaolizer 26;Lupragen N 107;N,N-Dimethyl[2-(2-hydroxyethoxy)ethyl]amine;N,N-Dimethyldiglycolamine;NSC3146;PC CAT NP 170;PC CAT NP 70;Tegoamin DMEE;Texacat ZR 70;Toyocat RX 3;ZR70; |
CAS: | 1704-62-7 |
EINECS: | 216-940-1 |
Molecular Formula: | C6H15NO2 |
Molecular Weight: | 133.19 |
InChI: | InChI=1/C6H15NO2/c1-7(2)3-5-9-6-4-8/h8H,3-6H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 0.954 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acids, isocyanates. |
Refractive index: | 1.442 |
Appearance: | liquid |
Specification: | liquid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |