Identification |
Name: | Benzoic acid,3,4-dihydroxy-5-[[3,4,5-tris[[(9Z)-1-oxo-9-octadecenyl]oxy]benzoyl]oxy]- |
Synonyms: | Benzoicacid, 3,4-dihydroxy-5-[[3,4,5-tris[(1-oxo-9-octadecenyl)oxy]benzoyl]oxy]-,(Z,Z,Z)-; Oleic acid, triester with gallic acid, 3-ester with gallic acid(8CI); Digalloyl trioleate |
CAS: | 17048-39-4 |
Molecular Formula: | C68H106 O12 |
Molecular Weight: | 1099.56264 |
InChI: | InChI=1/C20H16O12/c1-8(21)29-15-6-12(7-16(30-9(2)22)18(15)31-10(3)23)20(28)32-14-5-11(19(26)27)4-13(24)17(14)25/h4-7,24-25H,1-3H3,(H,26,27) |
Molecular Structure: |
|
Properties |
Flash Point: | 243.2°C |
Boiling Point: | 689.9°C at 760 mmHg |
Density: | 1.519g/cm3 |
Refractive index: | 1.612 |
Flash Point: | 243.2°C |
Safety Data |
|
|