Identification |
Name: | Benzoxazole,2-[1,1'-biphenyl]-4-yl-6-phenyl- |
Synonyms: | Benzoxazole,2-(4-biphenylyl)-6-phenyl- (8CI); 2-(4-Biphenylyl)-6-phenylbenzoxazole;2-(4'-Biphenylyl)-6-phenyl-benzoxale; 2-(4'-Biphenylyl)-6-phenylbenzoxazole;PBBO |
CAS: | 17064-47-0 |
EINECS: | 241-125-2 |
Molecular Formula: | C25H17 N O |
Molecular Weight: | 347.40858 |
InChI: | InChI=1S/C25H17NO/c1-3-7-18(8-4-1)20-11-13-21(14-12-20)25-26-23-16-15-22(17-24(23)27-25)19-9-5-2-6-10-19/h1-17H |
Molecular Structure: |
|
Properties |
Melting Point: | 198-199 °C(lit.)
|
Flash Point: | 224.4°C |
Boiling Point: | 518°Cat760mmHg |
Density: | 1.175g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.653 |
Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin.Toxicology not fully investigated. Toxicity da |
Solubility: | |
Appearance: | white to light yellow crystals |
Flash Point: | 224.4°C |
Safety Data |
|
|