Identification |
Name: | Benzonitrile,4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]-1-piperazinyl]- |
Synonyms: | Piperazine,1-[[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]-4-(4-cyanophenyl)- (9CI);Donitriptan |
CAS: | 170912-52-4 |
Molecular Formula: | C23H25 N5 O2 |
Molecular Weight: | 403.4769 |
InChI: | InChI=1/C23H25N5O2/c24-8-7-18-15-26-22-6-5-20(13-21(18)22)30-16-23(29)28-11-9-27(10-12-28)19-3-1-17(14-25)2-4-19/h1-6,13,15,26H,7-12,16,24H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 393.6°C |
Boiling Point: | 727.1°Cat760mmHg |
Density: | 1.32g/cm3 |
Refractive index: | 1.688 |
Biological Activity: | Brain penetrant 5-HT 1B/1D agonist (pK i values are 9.3 and 9.4 for 5-HT 1D and 5-HT 1B respectively). Inhibits capsaicin-induced external carotid vasodilation and produces selective carotid vasoconstriction in various animal species. Displays antimigraine activity. |
Flash Point: | 393.6°C |
Safety Data |
|
|