| Identification | |
| Name: | 1,4-Benzodioxin,5-(2-bromoethoxy)-2,3-dihydro- |
| Synonyms: | 1,4-Benzodioxan,5-(2-bromoethoxy)- (7CI,8CI); 5-(2-Bromoethoxy)-1,4-benzodioxan;5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxin;5-(2-Bromoethoxy)-2,3-dihydrobenzo[1,4]dioxine;5-(2-Bromoethyloxy)-1,4-benzodioxane; 5-(b-Bromoethoxy)-1,4-benzodioxan |
| CAS: | 1710-62-9 |
| Molecular Formula: | C10H11 Br O3 |
| Molecular Weight: | 259.1 |
| InChI: | InChI=1/C10H11BrO3/c11-4-5-12-8-2-1-3-9-10(8)14-7-6-13-9/h1-3H,4-7H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 85°C |
| Flash Point: | 131.6°C |
| Boiling Point: | 325.1°Cat760mmHg |
| Density: | 1.506g/cm3 |
| Refractive index: | 1.565 |
| Specification: | Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 131.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
