| Identification | |
| Name: | 7H-Benz[de]anthracen-7-one,3-nitro- |
| Synonyms: | 3-Nitro-7H-benz[de]anthracen-7-one;3-Nitrobenzanthrone |
| CAS: | 17117-34-9 |
| Molecular Formula: | C17H9 N O3 |
| Molecular Weight: | 275.27 |
| InChI: | InChI=1/C17H9NO3/c19-17-12-5-2-1-4-10(12)11-8-9-15(18(20)21)13-6-3-7-14(17)16(11)13/h1-9H |
| Molecular Structure: | ![(C17H9NO3) 3-Nitro-7H-benz[de]anthracen-7-one;3-Nitrobenzanthrone](https://img1.guidechem.com/chem/e/dict/24/17117-34-9.jpg) |
| Properties | |
| Melting Point: | 248ºC |
| Flash Point: | 256.6°C |
| Boiling Point: | 506.2°C at 760 mmHg |
| Density: | 1.442g/cm3 |
| Refractive index: | 1.757 |
| Specification: |
3-Nitrobenzanthrone (CAS NO.17117-34-9) is a chemical emitted in the exhaust fumes of diesel engines which is a potent carcinogen. It produced the highest score ever reported in the Ames test, a standard measure of the cancer-causing potential of toxic chemicals, far greater than the previous known strongest 1,8-dinitropyrene which also found in diesel exhaust. |
| Flash Point: | 256.6°C |
| Safety Data | |
 |
|
