| Identification | |
| Name: | 3-oxo-3-[(2-phenylethyl)amino]propane-1-sulfinic acid - 2-phenylethanamine (1:1) |
| Synonyms: | 2-Phenylethylammonium salt of the 2-phenylethylamide of beta-sulfinopropionic acid;1-Propanesulfinic acid, 3-oxo-3-((2-phenylethyl)amino)-, compd. with benzeneethanamine (1:1);3-Oxo-3-((2-phenylethyl)amino)-1-propanesulfinic acid compd. with benzeneethanamine (1:1);AC1MIOR6;LS-120911;3-oxo-3-(phenethylamino)propane-1-sulfinic acid; 2-phenylethanamine;171359-12-9 |
| CAS: | 171359-12-9 |
| Molecular Formula: | C19H26N2O3S |
| Molecular Weight: | 362.4863 |
| InChI: | InChI=1/C11H15NO3S.C8H11N/c13-11(7-9-16(14)15)12-8-6-10-4-2-1-3-5-10;9-7-6-8-4-2-1-3-5-8/h1-5H,6-9H2,(H,12,13)(H,14,15);1-5H,6-7,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 349.9°C |
| Boiling Point: | 655°C at 760 mmHg |
| Flash Point: | 349.9°C |
| Safety Data | |
 |
|
