| Identification | |
| Name: | 9(10H)-Anthracenone,1-hydroxy- |
| Synonyms: | Anthrone,1-hydroxy- (6CI,7CI,8CI); 1-Hydroxy-9-anthrone; 1-Hydroxyanthrone |
| CAS: | 1715-81-7 |
| Molecular Formula: | C14H10 O2 |
| Molecular Weight: | 210.24 |
| InChI: | InChI=1/C14H10O2/c15-12-7-3-5-10-8-9-4-1-2-6-11(9)14(16)13(10)12/h1-7,15H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.9°C |
| Boiling Point: | 402.6°Cat760mmHg |
| Density: | 1.305g/cm3 |
| Refractive index: | 1.673 |
| Specification: |
9-Anthronol (CAS NO.1715-81-7) is a toxic chemecal, flammable,thermal decomposition would release stimulation Smoke,it chould be stored in low temperature, ventilation, drying environmental conditions,separated with food and raw materials, besides water, carbon oxides and oxidation of toxic carbon dioxide, dry powder, sand, water mist fire extinguishing agent can be used if emergency. |
| Report: |
Reported in JMCMAR Journal of Medicinal Chemistry. |
| Flash Point: | 171.9°C |
| Safety Data | |
 |
|
