| Identification | |
| Name: | Benzenebutanoic acid,sodium salt (1:1) |
| Synonyms: | Benzenebutanoicacid, sodium salt (9CI);NSC 657802;Butyric acid, 4-phenyl-, sodium salt (8CI);Buphenyl;Sodium g-phenylbutyrate;Sodium phenylbutyrate;TriButyrate; |
| CAS: | 1716-12-7 |
| Molecular Formula: | C10H11NaO2 |
| Molecular Weight: | 186.18 |
| InChI: | InChI=1/C10H12O2.Na/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8H2,(H,11,12);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 187.9°C |
| Boiling Point: | 290.7°Cat760mmHg |
| Density: | 1.095g/cm3 |
| Specification: |
Sodium 4-phenylbutyrate (CAS NO.1716-12-7), its Synonyms are Phenylbutyrate ; Buphenyl ; Sodium phenylbutyrate ; TriButyrate ; Benzenebutanoic acid, sodium salt ; 4-Phenylbutyric acid sodium salt . |
| Biological Activity: | Histone deacetylase inhibitor that displays anticancer activity. Inhibits cell proliferation, invasion and migration and induces apoptosis in glioma cells. Also inhibits protein isoprenylation, depletes plasma glutamine, increases production of fetal hemoglobin through transcriptional activation of the γ -globin gene and affects hPPAR γ activation. |
| Flash Point: | 187.9°C |
| Safety Data | |
 |
|
