| Identification | |
| Name: | Dibenzyl phosphite |
| Synonyms: | Dibenzyl phosphonate; Phosphonic acid dibenzyl ester; Phosphorous acid dibenzyl ester; Bromine Hydride Acetic Acid |
| CAS: | 17176-77-1 |
| EINECS: | 241-226-1 |
| Molecular Formula: | C14H15O3P |
| Molecular Weight: | 262.24 |
| InChI: | InChI=1/C14H15O3P/c15-18(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10,18H,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3278 |
| Melting Point: | 17 |
| Density: | 1.187 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May decompose on exposure to moist air or water. |
| Refractive index: | 1.555 |
| Solubility: | Insoluble |
| Appearance: | Clear slightly yellow liquid. |
| Specification: |
Dibenzyl phosphite ,its CAS NO. is 17176-77-1,the synonyms is Aurora ka-1209 ; Dibenzyl phosphonate ; Phosphonic acid dibenzyl ester ; Phosphorous acid dibenzyl ester ; O,o'-dibenzylphosphine ; Dibenzyl hydrogen phosphite ; Phosphonic acid, bis(phenylmethyl) ester . |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air & Moisture Sensitive |
| Usage: | Substance is used in preparation of n-phosphorylated amines. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
