| Identification | |
| Name: | Benzene,1,1'-(1,3,5-hexatriene-1,6-diyl)bis- |
| Synonyms: | 1,3,5-Hexatriene,1,6-diphenyl- (6CI,8CI);1,6-Diphenyl-1,3,5-hexatriene;1,6-Diphenylhexatriene;DPH (dye);Diphenylhexatriene;NSC 90479;a,w-Diphenylhexatriene; |
| CAS: | 1720-32-7 |
| EINECS: | 217-011-3 |
| Molecular Formula: | C18H16 |
| Molecular Weight: | 232.32 |
| InChI: | InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 199-203 °C(lit.) |
| Flash Point: | 221°C |
| Boiling Point: | 407.2°Cat760mmHg |
| Density: | 1.028g/cm3 |
| Refractive index: | 1.585 |
| Appearance: | Yellow crystalline powder or crystals |
| Specification: | YELLOW CRYSTALLINE POWDER OR CRYSTALS usageEng:A useful fluorescence probe for membrane studies based on investigation of fluorescence depolarisation; Membrane fluidity by flow cytometry. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 221°C |
| Usage: | A useful fluorescence probe for membrane studies based on investigation of fluorescence depolarisation; Membrane fluidity by flow cytometry. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
