| Identification | |
| Name: | oleic acid, compound with diethylamine (1:1) |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with N-ethylethanamine (1:1);9-Octadecenoic acid (Z), compd. with N-ethylethanamine;Oleic acid, compound with diethylamine (1:1);(9Z)-octadec-9-enoic acid - N-ethylethanamine (1:1) |
| CAS: | 17200-00-9 |
| EINECS: | 241-242-9 |
| Molecular Formula: | C22H45NO2 |
| Molecular Weight: | 355.5982 |
| InChI: | InChI=1/C18H34O2.C4H11N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-4-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);5H,3-4H2,1-2H3/b10-9-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data | |
 |
|
