| Identification | |
| Name: | 1,3,5-Triazine,2-phenyl- |
| Synonyms: | s-Triazine,2-phenyl- (6CI,7CI,8CI);2-Phenyl-1,3,5-triazine;2-Phenyl-s-triazine;Phenyl-1,3,5-triazine; |
| CAS: | 1722-18-5 |
| Molecular Formula: | C9H7 N3 |
| Molecular Weight: | 157.1744 |
| InChI: | InChI=1/C9H7N3/c1-2-4-8(5-3-1)9-11-6-10-7-12-9/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.169 g/cm3 |
| Refractive index: | 1.586 |
| Specification: |
The Phenyl-1,3,5-triazine, with the cas registry number 1722-18-5, has its systematic name of 2-phenyl-1,3,5-triazine. Its product categories are including pyrimidine; quinazoline. As to its usage, it is usually used to produce painting when mixed with alkyd resins, and acrylic resin. The characteristics of this chemical are as below: (1)ACD/LogP: 1.93 ; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.93; (4)ACD/LogD (pH 7.4): 1.93; (5)ACD/BCF (pH 5.5): 17.14; (6)ACD/BCF (pH 7.4): 17.14; (7)ACD/KOC (pH 5.5): 266.02; (8)ACD/KOC (pH 7.4): 266.05; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 38.67; (13)Index of Refraction: 1.586; (14)Molar Refractivity: 45.11 cm3; (15)Molar Volume: 134.3 cm3; (16)Polarizability: 17.88 ×10-24 cm3; (17)Surface Tension: 53.2 dyne/cm; (18)Density: 1.169 g/cm3; (19)Flash Point: 163.7 °C; (20)Enthalpy of Vaporization: 56.23 kJ/mol; (21)Boiling Point: 341.8 °C at 760 mmHg; (22)Vapour Pressure: 0.000155 mmHg at 25°C. Additionally, you could convert the following datas into the molecular structure: |
| Safety Data | |
 |
|
