| Identification | |
| Name: | Pyridine,2-chloro-6-methoxy- |
| Synonyms: | 2-Methoxy-6-chloropyridine;6-Chloro-2-methoxypyridine; |
| CAS: | 17228-64-7 |
| EINECS: | 241-264-9 |
| Molecular Formula: | C6H6ClNO |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C6H6ClNO/c1-9-6-4-2-3-5(7)8-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 169? |
| Density: | 1.207 |
| Refractive index: | 1.528 |
| Appearance: | Colorless to pale yellow liquid |
| Specification: |
2-Chloro-6-methoxypyridine (CAS NO.17228-64-7) is also named as 2-Chlor-6-methoxypyridin ; Pyridine, 2-chloro-6-methoxy- ; 2-Methoxy-6-Chloropyridine . It is clear colorless to light yellow liquid. |
| Packinggroup: | III |
| Flash Point: | 169? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
