| Identification | |
| Name: | Methyl 4-imidazolecarboxylate |
| Synonyms: | 1H-Imidazole-5-carboxylicacid, methyl ester;Imidazole-4(or 5)-carboxylic acid, methyl ester(7CI);3H-Imidazole-4-carboxylic acid methyl ester;4(5)-Imidazolecarboxylic acidmethyl ester;Methyl 1H-imidazole-4-carboxylate;Methyl imidazole-4(or 5)-carboxylate;Methylimidazole-5-carboxylate; |
| CAS: | 17325-26-7 |
| Molecular Formula: | C5H6N2O2 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C5H6N2O2/c1-9-5(8)4-2-6-3-7-4/h2-3H,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.2°C |
| Boiling Point: | 318.2°Cat760mmHg |
| Density: | 1.275g/cm3 |
| Refractive index: | 1.53 |
| Appearance: | White crystalline powder |
| Specification: |
Methyl 4-imidazolecarboxylate , its cas register number is 17325-26-7. It also can be called 1H-Imidazole-4-carboxylic acid, methyl ester ; and Methyl 1H-imidazole-4-carboxylate . |
| Flash Point: | 146.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
