Identification |
Name: | Ethanamine,2,2'-dithiobis[N,N-dimethyl-, hydrochloride (1:2) |
Synonyms: | Ethanamine,2,2'-dithiobis[N,N-dimethyl-, dihydrochloride (9CI); Ethylamine, 2,2'-dithiobis[N,N-dimethyl-,dihydrochloride (6CI,7CI,8CI); 2,2'-Bis(dimethylamino)diethyl disulfidedihydrochloride; Bis(b-dimethylaminoethyl)disulfide dihydrochloride;Bis[2-(N,N-dimethylamino)ethyl] disulfide dihydrochloride;N,N,N',N'-Tetramethylcystamine dihydrochloride |
CAS: | 17339-60-5 |
EINECS: | 405-300-9 |
Molecular Formula: | C8H20 N2 S2 . 2 Cl H |
Molecular Weight: | 281.34 |
InChI: | InChI=1/C11H12N2O3.ClH/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10;/h1-2,4-5,9,13-14H,3,12H2,(H,15,16);1H/t9-;/m0./s1 |
Molecular Structure: |
 |
Properties |
Transport: | 3077 |
Flash Point: | 108.7 ºC |
Boiling Point: | 256.1 ºCat 760 mmHg |
Density: | 1.026 g/cm3 |
Specification: |
Its extinguishing agent are foam, sand, carbon dioxide, water mist and dry powder.
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 108.7 ºC |
Safety Data |
Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
|
 |