Identification |
Name: | 2H-1,3,2-Oxazaphosphorin-4,5-d2-2-amine,N,N-bis(2-chloroethyl)tetrahydro-4,5-d2-, 2-oxide (9CI) |
Synonyms: | Cycloblastin-d4;Cyclophosphamide-d4;Cyclostin-d4;Cytoxan-d4;Endoxan-d4;Genoxal-d4;Hexadrin-d4;Mitoxan-d4 |
CAS: | 173547-45-0 |
Molecular Formula: | C7H11 Cl2 D4 N2 O2 P |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12)/i1D2,4D2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 41-450C |
Flash Point: | 157.068°C |
Boiling Point: | 336.099°C at 760 mmHg |
Density: | 1.355g/cm3 |
Refractive index: | 1.506 |
Flash Point: | 157.068°C |
Usage: | It is a cytotoxic nitrogen mustard derivative widely used in cancer chemotherapy. It cross-links DNA, causes strand breakage, and induces mutations. Its clinical activity is associated with a decrease in aldehyde dehydrogenase 1 (ALDH1) activity. Th |
Safety Data |
|
 |