| Identification | |
| Name: | L-Leucine benzyl ester p-toluenesulfonate salt |
| CAS: | 1738-77-8 |
| EINECS: | 217-095-1 |
| Molecular Formula: | C13H19NO2.C7H8O3S |
| Molecular Weight: | 393.5 |
| InChI: | InChI=1/C13H19NO2.C7H8O3S/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10,12H,8-9,14H2,1-2H3;2-5H,1H3,(H,8,9,10)/t12-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.6 ºC |
| Boiling Point: | 302.5 ºC at 760 mmHg |
| Refractive index: | 5 ° (C=2, DMF) |
| Appearance: | White powder with lumps |
| Specification: |
L-Leucine benzyl ester p-toluenesulfonate salt , its cas register number is 1738-77-8. It also can be called O-Benzyl-L-leucine toluene-p-sulphonate . |
| Flash Point: | 157.6 ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
