| Identification | |
| Name: | 13427-42-4 |
| Synonyms: | Cerussete;Lead(2+) carbonate;LEAD CARBONATE;Cerussite;Plumbous carbonate;Dibasic lead carbonate;Lead carbonate (PbCO3);HSDB 1649;EINECS 209-943-4;Carbonic acid, lead(2+) salt (1:1);Lead(II) carbonate;598-63-0;17398-75-3;AC1L1XZR;Carbonic acid, lead salt;LEAD CARBONATE, ACS;UNII-43M0P24L2B;Carbonic acid, lead(2+) salt;EINECS 247-054-3;AG-G-13691;Carbonic acid, lead(2+) salt (1:?);LS-87677;I14-19293;13427-42-4;25510-11-6;64470-66-2 |
| CAS: | 17398-75-3 |
| Molecular Formula: | CO3Pb |
| Molecular Weight: | 267.2089 |
| InChI: | InChI=1S/CH2O3.Pb/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 315 deg C, decomposes |
| Flash Point: | 169.8°C |
| Boiling Point: | 333.6°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Sol in acids and alkalies; insoluble in alcohol and ammonia In water, 0.00011 g/100 mL at 20 deg C |
| Flash Point: | 169.8°C |
| Color: | Colorless, rhombic crystals |
| Safety Data | |
 |
|
