| Identification | |
| Name: | 6'-Methyl-5'-(p-dimethylaminophenylazo)quinoline |
| Synonyms: | N,N-dimethyl-4-(6-methylquinolin-5-yl)diazenyl-aniline |
| CAS: | 17400-70-3 |
| Molecular Formula: | C18H18N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H18N4/c1-13-6-11-17-16(5-4-12-19-17)18(13)21-20-14-7-9-15(10-8-14)22(2)3/h4-12H,1-3H3/b21-20+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 248.7°C |
| Boiling Point: | 487.6°C at 760 mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.614 |
| Specification: |
6'-Methyl-5'-(p-dimethylaminophenylazo)quinoline , its cas register number is 17400-70-3. It also can be called 5-((p-(Dimethylamino)phenyl)azo)-6-methylquinoline ; N,N-Dimethyl-4-(5'-(6'-methylquinolyl)azo)aniline ; and Quinoline, 5-((p-(dimethylamino)phenyl)azo)-6-methyl- . Its classification code is DTumor data. |
| Flash Point: | 248.7°C |
| Safety Data | |
 |
|
