| Identification | |
| Name: | 1,4-Benzodioxin,5,6,7,8-tetrafluoro-2,3-dihydro- |
| Synonyms: | 5,6,7,8-TETRAFLUOROBENZO-1,4-DIOXANE;5,6,7,8-TETRAFLUOROBENZO-1,4-DIOXENE |
| CAS: | 1743-87-9 |
| Molecular Formula: | C8H4 F4 O2 |
| Molecular Weight: | 208.11 |
| InChI: | InChI=1/C8H4F4O2/c9-3-4(10)6(12)8-7(5(3)11)13-1-2-14-8/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 78-79°C |
| Flash Point: | 73.7°C |
| Boiling Point: | 187.6°Cat760mmHg |
| Density: | 1.539g/cm3 |
| Refractive index: | 1.459 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 73.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
