| Identification | |
| Name: | Ethyl 2-(bromomethyl)acrylate |
| Synonyms: | Acrylicacid, 2-(bromomethyl)-, ethyl ester (7CI,8CI);2-(Bromomethyl)-2-propenoic acidethyl ester;2-Carbethoxyallyl bromide;Ethyl 2-(bromomethyl)-2-propenoate;Ethyl 2-(bromomethyl)propenoate;Ethyl3-bromo-2-(methylene)propanoate;Ethyl 3-bromo-2-methylenepropionate;Ethylbromomethacrylate;Ethyl a-(bromomethyl)acrylate;Ethyl a-bromomethacrylate;NSC 215252;2-Propenoic acid,2-(bromomethyl)-, ethyl ester; |
| CAS: | 17435-72-2 |
| Molecular Formula: | C6H9BrO2 |
| Molecular Weight: | 193.04 |
| InChI: | InChI=1S/C6H9BrO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 178? |
| Refractive index: | n20/D 1.479(lit.) |
| Appearance: | Colourless Oil |
| Specification: |
Ethyl 2-(bromomethyl)acrylate (CAS NO.17435-72-2), its Synonyms are Propenoic acid, 2-(bromomethyl)-, ethyl ester ; Acrylicacid, 2-(bromomethyl)-, ethyl ester (7CI,8CI) ; 2-(Bromomethyl)-2-propenoic acidethyl ester ; 2-Carbethoxyallyl bromide ; Ethyl 2-(bromomethyl)-2-propenoate ; Ethyl a-(bromomethyl)acrylate ; 2-Propenoic acid,2-(bromomethyl)-, ethyl ester . |
| Flash Point: | 178? |
| Storage Temperature: | 2-8°C |
| Usage: |
Ethyl 2-(bromomethyl)acrylate (CAS NO.17435-72-2) is an intermediate used for the synthesis of aza inhibitors of chorismate mutase. |
| Safety Data | |
 |
|
