| Identification | |
| Name: | 1-Butyl-3-methylimidazolium hexafluorophosphate |
| Synonyms: | BmimPF6; |
| CAS: | 174501-64-5 |
| Molecular Formula: | C8H15N2.PF6 |
| Molecular Weight: | 284.18 |
| InChI: | InChI=1/C8H16N2.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-7H,3-5,8H2,1-2H3;/q;-1/p+1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | >340°C |
| Density: | 1.3727 |
| Refractive index: | 1.41 |
| Solubility: | non-water soluble |
| Appearance: | Clear pale yellow oil |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. Use and store under nitrogen.Store in a cool, dry place. Store in a tightly closed container. Store under nitrogen. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
