| Identification | |
| Name: | Benzene,1-bromo-4-(2-bromoethyl)- |
| Synonyms: | 4-Bromo-1-(2-bromoethyl)benzene;4-Bromophenethyl bromide;1-Bromo-4-(2-bromoethyl)benzene;2-(4-Bromophenyl)ethyl bromide;2-(p-Bromophenyl)ethyl bromide;4-(2-Bromoethyl)-1-bromobenzene;1-(2-Bromoethyl)-4-bromobenzene; |
| CAS: | 1746-28-7 |
| Molecular Formula: | C8H8Br2 |
| Molecular Weight: | 263.96 |
| InChI: | InChI=1/C8H8Br2/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Flash Point: | >230 °F |
| Boiling Point: | 97-98.5 °C1 mm Hg(lit.) |
| Density: | 1.7272 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.5954(lit.) |
| Specification: | Safety Statements:60-61 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | >230 °F |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
