| Identification | |
| Name: | Urea,N'-(4-chlorophenyl)-N-methoxy-N-methyl- |
| Synonyms: | Urea,3-(p-chlorophenyl)-1-methoxy-1-methyl- (6CI,8CI);1-Methoxy-1-methyl-3-(4-chlorophenyl)urea;3-(4-Chlorophenyl)-1-methoxy-1-methylurea;3-(4-Chlorophenyl)-1-methyl-1-methoxyurea;Aresin;Arezin;Arezine;Monolinuron;Monorotox;N-(4-Chlorophenyl)-N'-methoxy-N'-methylurea;N-4-Chlorophenyl-N'-methyl-N'-methoxyurea;N-Methyl-N-methoxy-N'-(4-chlorophenyl)urea;N'-(4-Chlorophenyl)-N-methoxy-N-methylurea;N'-(4-Chlorophenyl)-N-methyl-N-methoxyurea; |
| CAS: | 1746-81-2 |
| EINECS: | 217-129-5 |
| Molecular Formula: | C9H11 Cl N2 O2 |
| Molecular Weight: | 214.67 |
| InChI: | InChI=1/C9H11ClN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.304g/cm3 |
| Refractive index: | 1.589 |
| Solubility: | 735 ppm in water at 20 deg C; sol in alcohol, acetone, benzene, toluene SOL IN DIOXANE, & XYLENE Water solubility = 930 mg/l at 20 deg C. Readily soluble in chloroform, diethyl ether. |
| Specification: |
Monolinuron ,its cas register number is 1746-81-2. It also can be called urea, N'-(4-chlorophenyl)-N-methoxy-N-methyl- ; and 3-(4-chlorophenyl)-1-methoxy-1-methylurea . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | °C |
| Storage Temperature: | 0-6°C |
| Color: | COLORLESS CRYSTALS |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
