| Identification | |
| Name: | 4-Amino-3-hydrazino-1,2,4-triazol-5-thiol |
| Synonyms: | 4-Amino-3-hydrazino-5-mercapto-1,2,4-triazole; AHMT ; 4-Amino-3-Hydradzino-5-Mercapto-1,2,4-Triazole |
| CAS: | 1750-12-5 |
| EINECS: | 217-135-8 |
| Molecular Formula: | C2H6N6S |
| Molecular Weight: | 146.17 |
| InChI: | InChI=1/C2H6N6S/c3-5-1-6-7-2(9)8(1)4/h3-4H2,(H,5,6)(H,7,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1325 |
| Density: | 2.31 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White to beige powder. |
| Specification: | Beige solid usageEng:A reagent for the determination of aldehydes and other reactive chemicals Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Usage: | A reagent for the determination of aldehydes and other reactive chemicals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
