Identification |
Name: | Benzoic acid,2-(acetyloxy)-, 3-[(nitrooxy)methyl]phenyl ester |
Synonyms: | 2-Acetoxybenzoicacid 3-nitrooxymethylphenyl ester;3-(Nitroxymethyl)phenyl 2-acetoxybenzoate;NCX 4016; |
CAS: | 175033-36-0 |
Molecular Formula: | C16H13 N O7 |
Molecular Weight: | 331.28 |
InChI: | InChI=1/C16H13NO7/c1-11(18)23-15-8-3-2-7-14(15)16(19)24-13-6-4-5-12(9-13)10-22-17(20)21/h2-9H,10H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 214.3°C |
Boiling Point: | 499.3°Cat760mmHg |
Density: | 1.347g/cm3 |
Refractive index: | 1.58 |
Flash Point: | 214.3°C |
Usage: | NO-Aspirin 1 is a hybrid molecule of aspirin and a nitric oxide (NO) donor. It contains an ester linkage, that when cleaved by esterases in the gut, liver, and plasma releases salicylate and an NO-releasing moiety. It also prevents restinosiis, i |
Safety Data |
|
 |