| Identification |
| Name: | Tapentadol hydrochloride |
| Synonyms: | Phenol,3-[(1R,2R)-3-(dimethylamino)-1-ethyl-2-methylpropyl]-, hydrochloride (9CI);Phenol, 3-[3-(dimethylamino)-1-ethyl-2-methylpropyl]-, hydrochloride,[R-(R*,R*)]-;Phenol,3-[(1R,2R)-3-(dimethylamino)-1-ethyl-2-methylpropyl]-, hydrochloride (1:1); |
| CAS: | 175591-09-0 |
| Molecular Formula: | C14H24ClNO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H23NO/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12/h6-9,11,14,16H,5,10H2,1-4H3/t11-,14+/m0/s1 |
| Molecular Structure: |
![(C14H24ClNO) Phenol,3-[(1R,2R)-3-(dimethylamino)-1-ethyl-2-methylpropyl]-, hydrochloride (9CI);Phenol, 3-[3-(dime...](https://img1.guidechem.com/chem/e/dict/174/175591-09-0.jpg) |
| Properties |
| Flash Point: | 134.2°C |
| Boiling Point: | 323.5°Cat760mmHg |
| Density: | 0.97g/cm3 |
| Refractive index: | 1.518 |
| Flash Point: | 134.2°C |
| Usage: | A novel, centrally acting oral analgesic with a dual mode of action that has demonstrated efficacy in preclinical and clinical models of pain relief. |
| Safety Data |
| |
 |
