| Identification | |
| Name: | 2-Propenoic acid,3-(3-methoxyphenyl)-, (2E)- |
| Synonyms: | 2-Propenoicacid, 3-(3-methoxyphenyl)-, (E)-; Cinnamic acid, m-methoxy-, (E)- (8CI);(2E)-3-(3-Methoxyphenyl)-2-propenoic acid; (E)-3-(3-Methoxyphenyl)-2-propenoicacid; (E)-3-Methoxycinnamic acid; (E)-m-Methoxycinnamic acid;trans-3-(3-Methoxyphenyl)-2-propenoic acid; trans-3-Methoxycinnamic acid;trans-m-Methoxycinnamic acid |
| CAS: | 17570-26-2 |
| EINECS: | 228-049-5 |
| Molecular Formula: | C10H10 O3 |
| Molecular Weight: | 178.1846 |
| InChI: | InChI=1S/C10H10O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-7H,1H3,(H,11,12)/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.195 g/cm3 |
| Specification: |
3-Methoxycinnamic acid with cas registry number of 17570-26-2 is also known as (2E)-3-(3-Methoxyphenyl)acrylic acid ; 2-Propenoic acid, 3-(3-methoxyphenyl)-, (2E)- ; (2E)-3-(3-Methoxyphenyl)prop-2-enoic acid ; (E)-3-(3-Methoxy-phenyl)-acrylic acid ; 2-Propenoic acid, 3-(3-methoxyphenyl)- ; 3-(3-Methoxyphenyl)acrylic acid . This compound is stable under normal temperatures and pressures, but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. 3-Methoxycinnamic acid with cas registry number of 17570-26-2 is an useful intermediate . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
