| Identification | |
| Name: | 7H-Pyrrolo[2,3-d]pyrimidine,5-bromo- |
| Synonyms: | 1H-Pyrrolo[2,3-d]pyrimidine,5-bromo- (9CI); |
| CAS: | 175791-49-8 |
| Molecular Formula: | C6H4BrN3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H4BrN3/c7-5-2-9-6-4(5)1-8-3-10-6/h1-3H,(H,8,9,10) |
| Molecular Structure: | ![(C6H4BrN3) 1H-Pyrrolo[2,3-d]pyrimidine,5-bromo- (9CI);](https://img1.guidechem.com/chem/e/dict/22/175791-49-8.jpg) |
| Properties | |
| Density: | 1.895 g/cm3 |
| Refractive index: | 1.746 |
| Specification: |
The cas register number of 5-Bromo-7H-pyrrolo[2,3-d]pyrimidine is 175791-49-8. It also can be called as 7H-Pyrrolo[2,3-d]pyrimidine,5-bromo- and the Systematic name about this chemical is 5-bromo-7H-pyrrolo[2,3-d]pyrimidine. It belongs to the Chiral chemicals. Physical properties about 5-Bromo-7H-pyrrolo[2,3-d]pyrimidine are: (1)ACD/LogP: 1.44; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 37; (5)ACD/KOC (pH 7.4): 37; (6)#H bond acceptors: 3; (7)#H bond donors: 1; (8)Polar Surface Area: 41.57Å2; (9)Index of Refraction: 1.746; (10)Molar Refractivity: 42.401 cm3; (11)Molar Volume: 104.504 cm3; (12)Polarizability: 16.809x10-24cm3; (13)Surface Tension: 76.935 dyne/cm. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
