| Identification | |
| Name: | Benzeneacetic acid,2,5-dimethoxy- |
| Synonyms: | Aceticacid, (2,5-dimethoxyphenyl)- (6CI,7CI,8CI);2,5-Dimethoxybenzeneacetic acid;2,5-Dimethoxyphenylacetic acid;2-(2,5-Dimethoxyphenyl)acetic acid;NSC 74696; |
| CAS: | 1758-25-4 |
| EINECS: | 217-151-5 |
| Molecular Formula: | C10H12O4 |
| Molecular Weight: | 196.2 |
| InChI: | InChI=1/C10H12O4/c1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.8°C |
| Boiling Point: | 341.2°Cat760mmHg |
| Density: | 1.189g/cm3 |
| Stability: | No data. |
| Solubility: | Insoluble |
| Appearance: | White solid. |
| Specification: | white to light brown crystalline powder Safety Statements:22-24/25-36/37-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | I; II; III |
| Flash Point: | 134.8°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
