| Identification | |
| Name: | 9,10-Anthracenedione,1,2-diamino- |
| Synonyms: | Anthraquinone,1,2-diamino- (7CI,8CI); 1,2-Diamino-9,10-anthraquinone;1,2-Diaminoanthraquinone; NSC 39934 |
| CAS: | 1758-68-5 |
| EINECS: | 217-156-2 |
| Molecular Formula: | C14H10 N2 O2 |
| Molecular Weight: | 238.24 |
| InChI: | InChI=1/C14H10N2O2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,15-16H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.456 g/cm3 |
| Refractive index: | 1.757 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
