| Identification | |
| Name: | Benzoic acid,2,3-difluoro-4-hydroxy- |
| Synonyms: | 2,3-Difluoro-4-hydroxybenzoicacid; 4-Hydroxy-2,3-difluorobenzoic acid |
| CAS: | 175968-39-5 |
| Molecular Formula: | C7H4 F2 O3 |
| Molecular Weight: | 174.1 |
| InChI: | InChI=1/C7H4F2O3/c8-5-3(7(11)12)1-2-4(10)6(5)9/h1-2,10H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 226.1°C |
| Boiling Point: | 450.2°Cat760mmHg |
| Density: | 1.273g/cm3 |
| Refractive index: | 1.557 |
| Specification: |
2,3-Difluoro-4-hydroxybenzoic acid (175968-39-5) is the organiccompound with the formula C7H4F2O3.The product categories aboutit are Blocks ; Carboxes ; Fluorocompounds ; Aromatic CarboxylicAcids, Amides, Anilides, Anhydrides & Salts ; Benzoic Acid andthe chemical synonymous are Rarechem Al Bo 1938 and 2,3-Diifluoro-4-Hydroxybenzoic Acid . |
| Flash Point: | 226.1°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
