Specification: |
The L-Isoleucine hydrochloride, with the CAS registry number 17694-98-3, belongs to the product categories of Alphabetic; Amino Acids, Peptides and Proteins; Amino AcidsAnalytical Standards; I and Life Sciences Standards. This chemical's molecular formula is C6H14ClNO2 and molecular weight is 167.63. What's more, systematic name of L-Isoleucine hydrochloride is called L-Isoleucine, hydrochloride (1:1).
You can still convert the following datas into molecular structure:
(1) SMILES: CCC(C)[C@@H](C(=O)O)N.Cl
(2) InChI: InChI=1/C6H13NO2.ClH/c1-3-4(2)5(7)6(8)9;/h4-5H,3,7H2,1-2H3,(H,8,9);1H/t4?,5-;/m0./s1
(3) InChIKey: GBKVTQSWZCBVSL-YKXIHYLHBL
|