| Identification |
| Name: | 1,4-Dioxa-8-azaspiro[4.5]decane |
| Synonyms: | 8-Aza-1,4-dioxaspiro[4.5]decane;4-Piperidinone ethylene acetal;4-Piperidinone, cyclic 1,2-ethanediyl acetal;4,4-(Ethylenedioxy)piperidine;4-Piperidone ethylene ketal;Piperidin-4-one ethylene ketal; |
| CAS: | 177-11-7 |
| EINECS: | 205-868-6 |
| Molecular Formula: | C7H13NO2 |
| Molecular Weight: | 143.18 |
| InChI: | InChI=1/C7H13NO2/c1-3-8-4-2-7(1)9-5-6-10-7/h8H,1-6H2 |
| Molecular Structure: |
![(C7H13NO2) 8-Aza-1,4-dioxaspiro[4.5]decane;4-Piperidinone ethylene acetal;4-Piperidinone, cyclic 1,2-ethanediyl...](https://img.guidechem.com/casimg/177-11-7.gif) |
| Properties |
| Density: | 1.117 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4809-1.4829 |
| Solubility: | Very soluble |
| Appearance: | Colorless to yellow liquid. |
| HS Code: | 29349990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
