| Identification | |
| Name: | Phenol,4-[[2-(1-methylethoxy)ethoxy]methyl]- |
| Synonyms: | 4-[(2-Isopropoxyethoxy)methyl]phenol;4-Isopropoxyethoxymethyl-1-hydroxy benzene; |
| CAS: | 177034-57-0 |
| Molecular Formula: | C12H18O3 |
| Molecular Weight: | 210.27 |
| InChI: | InChI=1/C12H18O3/c1-10(2)15-8-7-14-9-11-3-5-12(13)6-4-11/h3-6,10,13H,7-9H2,1-2H3 |
| Molecular Structure: | ![(C12H18O3) 4-[(2-Isopropoxyethoxy)methyl]phenol;4-Isopropoxyethoxymethyl-1-hydroxy benzene;](https://img.guidechem.com/casimg/177034-57-0.gif) |
| Properties | |
| Density: | 1.044g/cm3 |
| Refractive index: | 1.509 |
| Appearance: | Pale Yellow Oil |
| Specification: |
Phenol,4-[[2-(1-methylethoxy)ethoxy]methyl]- (CAS NO.177034-57-0), its Synonyms are 4-Isopropoxyethoxymethylphenol ; 4-Isopropoxyethoxymethyl-1-hydroxy benzene . |
| Usage: |
Phenol,4-[[2-(1-methylethoxy)ethoxy]methyl]- (CAS NO.177034-57-0) is used as an intermediate for the synthesis of Bisoprolol . |
| Safety Data | |
 |
|
